C17H18BrNO4S2 — CID 35532972
2-bromo-4-methyl-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzenesulfonamide (PubChem CID 35532972) has the molecular formula C17H18BrNO4S2 and a molecular weight of 444.37 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-methyl-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35532972 |
| Molecular Formula | C17H18BrNO4S2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 2-bromo-4-methyl-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzenesulfonamide |
| SMILES | C=CCS(=O)(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(C)cc2Br)c1 |
| InChI | InChI=1S/C17H18BrNO4S2/c1-4-9-24(20,21)14-7-6-13(3)16(11-14)19-25(22,23)17-8-5-12(2)10-15(17)18/h4-8,10-11,19H,1,9H2,2-3H3 |
| InChIKey | XUANTCIWMYTHPA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|