About 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate
1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate (PubChem CID 3553603) has the molecular formula C8H8N2O3S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate.
Molecular Properties
| Compound Name | 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate |
| PubChem CID | 3553603 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate |
| SMILES | C[n+]1ccn2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C8H8N2O3S/c1-9-4-5-10-6-7(14(11,12)13)2-3-8(9)10/h2-6H,1H3 |
| InChIKey | ZUFZPAJCEJFRQR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate?
The IUPAC name of 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate (CID 3553603) is 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate.
What is the SMILES notation for 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate?
The canonical SMILES for 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate is C[n+]1ccn2cc(S(=O)(=O)[O-])ccc21.
What is the InChIKey of 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate?
The InChIKey is ZUFZPAJCEJFRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c1-9-4-5-10-6-7(14(11,12)13)2-3-8(9)10/h2-6H,1H3.
What are the key properties of 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate?
1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate has a molecular weight of 212.23 g/mol, XLogP of -0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazo[1,2-a]pyridin-1-ium-6-sulfonate is sourced from PubChem (CID 3553603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).