C22H25N3O4S2 — CID 35538236
4-[methoxy(methyl)sulfamoyl]-N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 35538236) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[methoxy(methyl)sulfamoyl]-N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[methoxy(methyl)sulfamoyl]-N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 35538236 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[methoxy(methyl)sulfamoyl]-N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCc1ccc(-c2nc(NC(=O)c3ccc(S(=O)(=O)N(C)OC)cc3)sc2C)cc1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-5-6-16-7-9-17(10-8-16)20-15(2)30-22(23-20)24-21(26)18-11-13-19(14-12-18)31(27,28)25(3)29-4/h7-14H,5-6H2,1-4H3,(H,23,24,26) |
| InChIKey | SZNBIYKSPXELGS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|