C17H22N2O4S3 — CID 35539936
N-(3-methoxypropyl)-2-(thiophen-2-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 35539936) has the molecular formula C17H22N2O4S3 and a molecular weight of 414.57 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(thiophen-2-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-(thiophen-2-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 35539936 |
| Molecular Formula | C17H22N2O4S3 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-(3-methoxypropyl)-2-(thiophen-2-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCCNC(=O)c1c(NS(=O)(=O)c2cccs2)sc2c1CCCC2 |
| InChI | InChI=1S/C17H22N2O4S3/c1-23-10-5-9-18-16(20)15-12-6-2-3-7-13(12)25-17(15)19-26(21,22)14-8-4-11-24-14/h4,8,11,19H,2-3,5-7,9-10H2,1H3,(H,18,20) |
| InChIKey | USAJZMTZKBAKDJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|