C27H36N4O6 — CID 3554714
1-N',5-N'-bis[2-(2-propan-2-ylphenoxy)acetyl]pentanedihydrazide (PubChem CID 3554714) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-N',5-N'-bis[2-(2-propan-2-ylphenoxy)acetyl]pentanedihydrazide.
| Compound Name | 1-N',5-N'-bis[2-(2-propan-2-ylphenoxy)acetyl]pentanedihydrazide |
|---|---|
| PubChem CID | 3554714 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 1-N',5-N'-bis[2-(2-propan-2-ylphenoxy)acetyl]pentanedihydrazide |
| SMILES | CC(C)c1ccccc1OCC(=O)NNC(=O)CCCC(=O)NNC(=O)COc1ccccc1C(C)C |
| InChI | InChI=1S/C27H36N4O6/c1-18(2)20-10-5-7-12-22(20)36-16-26(34)30-28-24(32)14-9-15-25(33)29-31-27(35)17-37-23-13-8-6-11-21(23)19(3)4/h5-8,10-13,18-19H,9,14-17H2,1-4H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35) |
| InChIKey | FDMLNPRSNDUWEA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|