About 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one
4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one (PubChem CID 3554793) has the molecular formula C22H21N3OS2
and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one |
| PubChem CID | 3554793 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one |
| SMILES | CCCC1=NN(c2ccccc2)C(=O)C1Sc1nc(-c2ccc(C)cc2)cs1 |
| InChI | InChI=1S/C22H21N3OS2/c1-3-7-18-20(21(26)25(24-18)17-8-5-4-6-9-17)28-22-23-19(14-27-22)16-12-10-15(2)11-13-16/h4-6,8-14,20H,3,7H2,1-2H3 |
| InChIKey | STSKRXGJLNAZCC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_5_D(2)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one?
The IUPAC name of 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one (CID 3554793) is 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one.
What is the SMILES notation for 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one?
The canonical SMILES for 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one is CCCC1=NN(c2ccccc2)C(=O)C1Sc1nc(-c2ccc(C)cc2)cs1.
What is the InChIKey of 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one?
The InChIKey is STSKRXGJLNAZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3OS2/c1-3-7-18-20(21(26)25(24-18)17-8-5-4-6-9-17)28-22-23-19(14-27-22)16-12-10-15(2)11-13-16/h4-6,8-14,20H,3,7H2,1-2H3.
What are the key properties of 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one?
4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one has a molecular weight of 407.56 g/mol, XLogP of 5.78, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-2-phenyl-5-propyl-4H-pyrazol-3-one is sourced from PubChem (CID 3554793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).