C24H20N4OS — CID 3555205
3-benzyl-2-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1,3-thiazolidin-4-one (PubChem CID 3555205) has the molecular formula C24H20N4OS and a molecular weight of 412.52 g/mol. Its IUPAC name is 3-benzyl-2-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-2-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3555205 |
| Molecular Formula | C24H20N4OS |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-benzyl-2-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cn(-c3ccccc3)nc2-c2cccnc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H20N4OS/c29-22-17-30-24(27(22)15-18-8-3-1-4-9-18)21-16-28(20-11-5-2-6-12-20)26-23(21)19-10-7-13-25-14-19/h1-14,16,24H,15,17H2 |
| InChIKey | ATQJTDXQSKPLGT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |