C27H33NO4 — CID 3555463
ethyl 2-[3,5-di(butan-2-yl)-4-methoxyphenyl]-3-formylindolizine-1-carboxylate (PubChem CID 3555463) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is ethyl 2-[3,5-di(butan-2-yl)-4-methoxyphenyl]-3-formylindolizine-1-carboxylate.
| Compound Name | ethyl 2-[3,5-di(butan-2-yl)-4-methoxyphenyl]-3-formylindolizine-1-carboxylate |
|---|---|
| PubChem CID | 3555463 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | ethyl 2-[3,5-di(butan-2-yl)-4-methoxyphenyl]-3-formylindolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cc(C(C)CC)c(OC)c(C(C)CC)c2)c(C=O)n2ccccc12 |
| InChI | InChI=1S/C27H33NO4/c1-7-17(4)20-14-19(15-21(18(5)8-2)26(20)31-6)24-23(16-29)28-13-11-10-12-22(28)25(24)27(30)32-9-3/h10-18H,7-9H2,1-6H3 |
| InChIKey | MVKJVFLJFLCPPH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|