C21H25ClN2O3 — CID 35557106
N-(3-chloro-2,6-diethylphenyl)-1-(furan-3-carbonyl)piperidine-4-carboxamide (PubChem CID 35557106) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-1-(furan-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-1-(furan-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 35557106 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-1-(furan-3-carbonyl)piperidine-4-carboxamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3/c1-3-14-5-6-18(22)17(4-2)19(14)23-20(25)15-7-10-24(11-8-15)21(26)16-9-12-27-13-16/h5-6,9,12-13,15H,3-4,7-8,10-11H2,1-2H3,(H,23,25) |
| InChIKey | UYOCYPINQDJESL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |