About 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide
2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide (PubChem CID 3555856) has the molecular formula C21H16N4O3
and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide.
Molecular Properties
| Compound Name | 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide |
| PubChem CID | 3555856 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide |
| SMILES | COc1ccccc1-c1noc(-c2ccccc2C(=O)Nc2cccnc2)n1 |
| InChI | InChI=1S/C21H16N4O3/c1-27-18-11-5-4-10-17(18)19-24-21(28-25-19)16-9-3-2-8-15(16)20(26)23-14-7-6-12-22-13-14/h2-13H,1H3,(H,23,26) |
| InChIKey | DQMNOBFRQDITQQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide?
The IUPAC name of 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide (CID 3555856) is 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide.
What is the SMILES notation for 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide?
The canonical SMILES for 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide is COc1ccccc1-c1noc(-c2ccccc2C(=O)Nc2cccnc2)n1.
What is the InChIKey of 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide?
The InChIKey is DQMNOBFRQDITQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O3/c1-27-18-11-5-4-10-17(18)19-24-21(28-25-19)16-9-3-2-8-15(16)20(26)23-14-7-6-12-22-13-14/h2-13H,1H3,(H,23,26).
What are the key properties of 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide?
2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide has a molecular weight of 372.38 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-pyridin-3-ylbenzamide is sourced from PubChem (CID 3555856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).