C22H25N5OS — CID 3556235
2-[4-(4-ethoxyphenyl)-3-ethyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 3556235) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-3-ethyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | 2-[4-(4-ethoxyphenyl)-3-ethyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 3556235 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-3-ethyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | CCOc1ccc(C2=CSC(=C(C#N)c3nnc4n3CCCCC4)N2CC)cc1 |
| InChI | InChI=1S/C22H25N5OS/c1-3-26-19(16-9-11-17(12-10-16)28-4-2)15-29-22(26)18(14-23)21-25-24-20-8-6-5-7-13-27(20)21/h9-12,15H,3-8,13H2,1-2H3 |
| InChIKey | AFQJSVUEYGIVJR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|