C18H16BrN3O — CID 3556359
N-(2-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 3556359) has the molecular formula C18H16BrN3O and a molecular weight of 370.25 g/mol. Its IUPAC name is N-(2-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(2-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 3556359 |
| Molecular Formula | C18H16BrN3O |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-(2-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H16BrN3O/c19-14-6-2-4-8-16(14)21-18(23)22-10-9-13-12-5-1-3-7-15(12)20-17(13)11-22/h1-8,20H,9-11H2,(H,21,23) |
| InChIKey | NGAXPVYFRQWEOQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|