C17H14BrClFNO4 — CID 35564996
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 35564996) has the molecular formula C17H14BrClFNO4 and a molecular weight of 430.66 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 35564996 |
| Molecular Formula | C17H14BrClFNO4 |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)OCC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H14BrClFNO4/c1-10-6-12(19)3-5-15(10)24-9-17(23)25-8-16(22)21-14-4-2-11(18)7-13(14)20/h2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | LYGKJZMPXWXAPW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |