About 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol
3,4-dihydro-2H-1,5-benzodioxepine-7-thiol (PubChem CID 3556879) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol |
| PubChem CID | 3556879 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol |
| SMILES | Sc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C9H10O2S/c12-7-2-3-8-9(6-7)11-5-1-4-10-8/h2-3,6,12H,1,4-5H2 |
| InChIKey | XBLKRYDMZYKNFI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol?
The IUPAC name of 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol (CID 3556879) is 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol.
What is the SMILES notation for 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol?
The canonical SMILES for 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol is Sc1ccc2c(c1)OCCCO2.
What is the InChIKey of 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol?
The InChIKey is XBLKRYDMZYKNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c12-7-2-3-8-9(6-7)11-5-1-4-10-8/h2-3,6,12H,1,4-5H2.
What are the key properties of 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol?
3,4-dihydro-2H-1,5-benzodioxepine-7-thiol has a molecular weight of 182.24 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,5-benzodioxepine-7-thiol is sourced from PubChem (CID 3556879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).