C17H24FN2O+ — CID 3557128
(6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-dipropylazanium (PubChem CID 3557128) has the molecular formula C17H24FN2O+ and a molecular weight of 291.39 g/mol. Its IUPAC name is (6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-dipropylazanium.
| Compound Name | (6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-dipropylazanium |
|---|---|
| PubChem CID | 3557128 |
| Molecular Formula | C17H24FN2O+ |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-dipropylazanium |
| SMILES | CCC[NH+](CCC)Cc1c(C)[nH]c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C17H23FN2O/c1-4-8-20(9-5-2)11-15-12(3)19-16-7-6-13(18)10-14(16)17(15)21/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,19,21)/p+1 |
| InChIKey | PVPTUGUBJOLNKD-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |