C20H25N5O3 — CID 3557301
N-(oxolan-2-ylmethyl)-N-[3-oxo-3-(2-pyridin-2-ylethylamino)propyl]pyrazine-2-carboxamide (PubChem CID 3557301) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-[3-oxo-3-(2-pyridin-2-ylethylamino)propyl]pyrazine-2-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-[3-oxo-3-(2-pyridin-2-ylethylamino)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3557301 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-[3-oxo-3-(2-pyridin-2-ylethylamino)propyl]pyrazine-2-carboxamide |
| SMILES | O=C(CCN(CC1CCCO1)C(=O)c1cnccn1)NCCc1ccccn1 |
| InChI | InChI=1S/C20H25N5O3/c26-19(24-9-6-16-4-1-2-8-22-16)7-12-25(15-17-5-3-13-28-17)20(27)18-14-21-10-11-23-18/h1-2,4,8,10-11,14,17H,3,5-7,9,12-13,15H2,(H,24,26) |
| InChIKey | PUCJMSOKXYIONP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |