C22H24N2O2S — CID 35574090
2-butoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 35574090) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-butoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 2-butoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 35574090 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-butoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H24N2O2S/c1-2-3-15-26-20-12-8-7-11-19(20)21(25)23-14-13-18-16-27-22(24-18)17-9-5-4-6-10-17/h4-12,16H,2-3,13-15H2,1H3,(H,23,25) |
| InChIKey | WFBQLYQJRAQQPY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|