C17H17ClN2O2 — CID 3557499
13-(2-chloroacetyl)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one (PubChem CID 3557499) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 13-(2-chloroacetyl)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one.
| Compound Name | 13-(2-chloroacetyl)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one |
|---|---|
| PubChem CID | 3557499 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 13-(2-chloroacetyl)-5-methyl-1,13-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5,9(16)-tetraen-8-one |
| SMILES | Cc1ccc2c(c1)c(=O)c1c3n2CCN(C(=O)CCl)C3CC1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-10-2-4-13-12(8-10)17(22)11-3-5-14-16(11)20(13)7-6-19(14)15(21)9-18/h2,4,8,14H,3,5-7,9H2,1H3 |
| InChIKey | OUTWDXPGWJBTIY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|