3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid

C7H12O2S2 — CID 3557887

IUPAC3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid
SMILESCC1(CCC(=O)O)SCCS1
InChIInChI=1S/C7H12O2S2/c1-7(3-2-6(8)9)10-4-5-11-7/h2-5H2,1H3,(H,8,9)
InChIKeyMCMHDCNNAZVZAV-UHFFFAOYSA-N
MW192.30 g/mol
LogP2.05
Rot. Bonds3

About 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid

3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid (PubChem CID 3557887) has the molecular formula C7H12O2S2 and a molecular weight of 192.30 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid
PubChem CID3557887
Molecular FormulaC7H12O2S2
Molecular Weight192.30 g/mol
Exact Mass192.03
IUPAC Name3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid
SMILESCC1(CCC(=O)O)SCCS1
InChIInChI=1S/C7H12O2S2/c1-7(3-2-6(8)9)10-4-5-11-7/h2-5H2,1H3,(H,8,9)
InChIKeyMCMHDCNNAZVZAV-UHFFFAOYSA-N
XLogP2.05
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.30
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid?
The IUPAC name of 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid (CID 3557887) is 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid.
What is the SMILES notation for 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid?
The canonical SMILES for 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid is CC1(CCC(=O)O)SCCS1.
What is the InChIKey of 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid?
The InChIKey is MCMHDCNNAZVZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S2/c1-7(3-2-6(8)9)10-4-5-11-7/h2-5H2,1H3,(H,8,9).
What are the key properties of 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid?
3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid has a molecular weight of 192.30 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-dithiolan-2-yl)propanoic acid is sourced from PubChem (CID 3557887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).