C28H40N2O2 — CID 35579281
2-butoxy-N-[(2R)-2-(4-tert-butylphenyl)-2-piperidin-1-ylethyl]benzamide (PubChem CID 35579281) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 2-butoxy-N-[(2R)-2-(4-tert-butylphenyl)-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 2-butoxy-N-[(2R)-2-(4-tert-butylphenyl)-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 35579281 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 2-butoxy-N-[(2R)-2-(4-tert-butylphenyl)-2-piperidin-1-ylethyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC[C@@H](c1ccc(C(C)(C)C)cc1)N1CCCCC1 |
| InChI | InChI=1S/C28H40N2O2/c1-5-6-20-32-26-13-9-8-12-24(26)27(31)29-21-25(30-18-10-7-11-19-30)22-14-16-23(17-15-22)28(2,3)4/h8-9,12-17,25H,5-7,10-11,18-21H2,1-4H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | JXHGUTMLPDRNII-VWLOTQADSA-N |
| XLogP | 6.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|