C20H17Cl2N3O2S — CID 3558290
5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 3558290) has the molecular formula C20H17Cl2N3O2S and a molecular weight of 434.35 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | 5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 3558290 |
| Molecular Formula | C20H17Cl2N3O2S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CN1CCc2c(sc3c2C(=O)NC(c2ccc(-c4cc(Cl)cc(Cl)c4)o2)N3)C1 |
| InChI | InChI=1S/C20H17Cl2N3O2S/c1-25-5-4-13-16(9-25)28-20-17(13)19(26)23-18(24-20)15-3-2-14(27-15)10-6-11(21)8-12(22)7-10/h2-3,6-8,18,24H,4-5,9H2,1H3,(H,23,26) |
| InChIKey | SKIOCWAJIPXETG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |