C26H21Cl2NO3 — CID 3558318
1-benzyl-5-(3,4-dichlorophenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 3558318) has the molecular formula C26H21Cl2NO3 and a molecular weight of 466.36 g/mol. Its IUPAC name is 1-benzyl-5-(3,4-dichlorophenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-benzyl-5-(3,4-dichlorophenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3558318 |
| Molecular Formula | C26H21Cl2NO3 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-benzyl-5-(3,4-dichlorophenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(Cc3ccccc3)C2c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C26H21Cl2NO3/c1-15-8-9-16(2)19(12-15)24(30)22-23(18-10-11-20(27)21(28)13-18)29(26(32)25(22)31)14-17-6-4-3-5-7-17/h3-13,23,30H,14H2,1-2H3 |
| InChIKey | PELBFBNRNJXYDC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|