C22H31ClN2O — CID 35583526
(2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1R,2R)-2-methylcyclohexyl]amino]propan-2-ol (PubChem CID 35583526) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1R,2R)-2-methylcyclohexyl]amino]propan-2-ol.
| Compound Name | (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1R,2R)-2-methylcyclohexyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 35583526 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1R,2R)-2-methylcyclohexyl]amino]propan-2-ol |
| SMILES | C[C@@H]1CCCC[C@H]1NC[C@@H](O)Cn1c2c(c3cccc(Cl)c31)CCCC2 |
| InChI | InChI=1S/C22H31ClN2O/c1-15-7-2-4-11-20(15)24-13-16(26)14-25-21-12-5-3-8-17(21)18-9-6-10-19(23)22(18)25/h6,9-10,15-16,20,24,26H,2-5,7-8,11-14H2,1H3/t15-,16-,20-/m1/s1 |
| InChIKey | ZHNJYJRWQXTHLL-JXXFODFXSA-N |
| XLogP | 4.70 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|