C16H12Cl2N2OS — CID 35591092
2,6-dichloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 35591092) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is 2,6-dichloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2,6-dichloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 35591092 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2,6-dichloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1ccc2sc(NC(=O)c3c(Cl)cccc3Cl)nc2c1C |
| InChI | InChI=1S/C16H12Cl2N2OS/c1-8-6-7-12-14(9(8)2)19-16(22-12)20-15(21)13-10(17)4-3-5-11(13)18/h3-7H,1-2H3,(H,19,20,21) |
| InChIKey | LIMBKYSHRXPFIZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |