C18H10Cl2N2O2S — CID 3559126
3-(3,4-dichlorophenyl)-5-phenyl-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 3559126) has the molecular formula C18H10Cl2N2O2S and a molecular weight of 389.26 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-phenyl-1H-thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(3,4-dichlorophenyl)-5-phenyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3559126 |
| Molecular Formula | C18H10Cl2N2O2S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-phenyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2scc(-c3ccccc3)c2c(=O)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl2N2O2S/c19-13-7-6-11(8-14(13)20)22-17(23)15-12(10-4-2-1-3-5-10)9-25-16(15)21-18(22)24/h1-9H,(H,21,24) |
| InChIKey | XMKRUAUAGJWOOW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |