C18H18F3N3O3 — CID 3559132
methyl 2-benzamido-2-[(4,6-dimethyl-2-pyridinyl)amino]-3,3,3-trifluoropropanoate (PubChem CID 3559132) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is methyl 2-benzamido-2-[(4,6-dimethyl-2-pyridinyl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-benzamido-2-[(4,6-dimethyl-2-pyridinyl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 3559132 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 2-benzamido-2-[(4,6-dimethyl-2-pyridinyl)amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1)(Nc1cc(C)cc(C)n1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O3/c1-11-9-12(2)22-14(10-11)23-17(16(26)27-3,18(19,20)21)24-15(25)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | IMGRMFPVLFHBFO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|