C13H13Cl2N3O — CID 35591649
N-(2,4-dichlorophenyl)-3-(1-methylpyrazol-4-yl)propanamide (PubChem CID 35591649) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-(1-methylpyrazol-4-yl)propanamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-(1-methylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 35591649 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-(1-methylpyrazol-4-yl)propanamide |
| SMILES | Cn1cc(CCC(=O)Nc2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C13H13Cl2N3O/c1-18-8-9(7-16-18)2-5-13(19)17-12-4-3-10(14)6-11(12)15/h3-4,6-8H,2,5H2,1H3,(H,17,19) |
| InChIKey | XVQOBYLEVUNHFR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |