About 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one
3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one (PubChem CID 3559188) has the molecular formula C17H31NO3
and a molecular weight of 297.44 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one.
Molecular Properties
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one |
| PubChem CID | 3559188 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one |
| SMILES | CC(C)C(CC(=O)N1CCOCC1)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C17H31NO3/c1-13(2)15(14-5-8-21-17(3,4)12-14)11-16(19)18-6-9-20-10-7-18/h13-15H,5-12H2,1-4H3 |
| InChIKey | LNRDXHLVGYUFPT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one?
The IUPAC name of 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one (CID 3559188) is 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one.
What is the SMILES notation for 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one?
The canonical SMILES for 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one is CC(C)C(CC(=O)N1CCOCC1)C1CCOC(C)(C)C1.
What is the InChIKey of 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one?
The InChIKey is LNRDXHLVGYUFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO3/c1-13(2)15(14-5-8-21-17(3,4)12-14)11-16(19)18-6-9-20-10-7-18/h13-15H,5-12H2,1-4H3.
What are the key properties of 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one?
3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one has a molecular weight of 297.44 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyloxan-4-yl)-4-methyl-1-morpholin-4-ylpentan-1-one is sourced from PubChem (CID 3559188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).