About 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione
5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 3559619) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| PubChem CID | 3559619 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(C)NC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C12H14N2O4/c1-12(10(15)13-11(16)14-12)7-4-5-8(17-2)9(6-7)18-3/h4-6H,1-3H3,(H2,13,14,15,16) |
| InChIKey | JXEXQYITISXIQL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione (CID 3559619) is 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione is COc1ccc(C2(C)NC(=O)NC2=O)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione?
The InChIKey is JXEXQYITISXIQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-12(10(15)13-11(16)14-12)7-4-5-8(17-2)9(6-7)18-3/h4-6H,1-3H3,(H2,13,14,15,16).
What are the key properties of 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione?
5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione has a molecular weight of 250.25 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione is sourced from PubChem (CID 3559619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).