About [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate
[3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate (PubChem CID 3560986) has the molecular formula C20H24N2O11
and a molecular weight of 468.42 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate |
| PubChem CID | 3560986 |
| Molecular Formula | C20H24N2O11 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Nc2ccccc2[N+](=O)[O-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H24N2O11/c1-10(23)29-9-16-17(30-11(2)24)18(31-12(3)25)19(32-13(4)26)20(33-16)21-14-7-5-6-8-15(14)22(27)28/h5-8,16-21H,9H2,1-4H3 |
| InChIKey | VEUZOPHINRTGCP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 169.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate?
The IUPAC name of [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate (CID 3560986) is [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate.
What is the SMILES notation for [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate?
The canonical SMILES for [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate is CC(=O)OCC1OC(Nc2ccccc2[N+](=O)[O-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate?
The InChIKey is VEUZOPHINRTGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O11/c1-10(23)29-9-16-17(30-11(2)24)18(31-12(3)25)19(32-13(4)26)20(33-16)21-14-7-5-6-8-15(14)22(27)28/h5-8,16-21H,9H2,1-4H3.
What are the key properties of [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate?
[3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate has a molecular weight of 468.42 g/mol, XLogP of 1.09, 8 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,5-triacetyloxy-6-(2-nitroanilino)oxan-2-yl]methyl acetate is sourced from PubChem (CID 3560986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).