C13H18FNO3S — CID 35611821
4-fluoro-2-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzenesulfonamide (PubChem CID 35611821) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35611821 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-fluoro-2-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N[C@@H](C)[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H18FNO3S/c1-9-8-11(14)5-6-13(9)19(16,17)15-10(2)12-4-3-7-18-12/h5-6,8,10,12,15H,3-4,7H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | WHLBEIHQGDJRRC-JQWIXIFHSA-N |
| XLogP | 1.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |