About 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide
3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide (PubChem CID 3561774) has the molecular formula C20H16N2O2
and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide.
Molecular Properties
| Compound Name | 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide |
| PubChem CID | 3561774 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc3c2ccc2cccn23)c1 |
| InChI | InChI=1S/C20H16N2O2/c1-24-16-7-2-5-14(13-16)20(23)21-18-8-3-9-19-17(18)11-10-15-6-4-12-22(15)19/h2-13H,1H3,(H,21,23) |
| InChIKey | MWUSGFOPNMJXFH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide?
The IUPAC name of 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide (CID 3561774) is 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide.
What is the SMILES notation for 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide?
The canonical SMILES for 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide is COc1cccc(C(=O)Nc2cccc3c2ccc2cccn23)c1.
What is the InChIKey of 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide?
The InChIKey is MWUSGFOPNMJXFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O2/c1-24-16-7-2-5-14(13-16)20(23)21-18-8-3-9-19-17(18)11-10-15-6-4-12-22(15)19/h2-13H,1H3,(H,21,23).
What are the key properties of 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide?
3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide has a molecular weight of 316.36 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzamide is sourced from PubChem (CID 3561774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).