C29H33N3O4 — CID 3561907
N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide (PubChem CID 3561907) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3561907 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCc2nc3ccccc3n2Cc2cc(C)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C29H33N3O4/c1-19-12-13-20(2)22(15-19)18-32-24-10-7-6-9-23(24)31-27(32)11-8-14-30-29(33)21-16-25(34-3)28(36-5)26(17-21)35-4/h6-7,9-10,12-13,15-17H,8,11,14,18H2,1-5H3,(H,30,33) |
| InChIKey | JCLYCNYDDWLMMQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|