About 4-methyl-2,6-diphenylthiopyrylium
4-methyl-2,6-diphenylthiopyrylium (PubChem CID 3562913) has the molecular formula C18H15S+
and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-methyl-2,6-diphenylthiopyrylium.
Molecular Properties
| Compound Name | 4-methyl-2,6-diphenylthiopyrylium |
| PubChem CID | 3562913 |
| Molecular Formula | C18H15S+ |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-methyl-2,6-diphenylthiopyrylium |
| SMILES | Cc1cc(-c2ccccc2)[s+]c(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H15S/c1-14-12-17(15-8-4-2-5-9-15)19-18(13-14)16-10-6-3-7-11-16/h2-13H,1H3/q+1 |
| InChIKey | BBIFSSHXMKXRCB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,6-diphenylthiopyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-diphenylthiopyrylium?
The IUPAC name of 4-methyl-2,6-diphenylthiopyrylium (CID 3562913) is 4-methyl-2,6-diphenylthiopyrylium.
What is the SMILES notation for 4-methyl-2,6-diphenylthiopyrylium?
The canonical SMILES for 4-methyl-2,6-diphenylthiopyrylium is Cc1cc(-c2ccccc2)[s+]c(-c2ccccc2)c1.
What is the InChIKey of 4-methyl-2,6-diphenylthiopyrylium?
The InChIKey is BBIFSSHXMKXRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S/c1-14-12-17(15-8-4-2-5-9-15)19-18(13-14)16-10-6-3-7-11-16/h2-13H,1H3/q+1.
What are the key properties of 4-methyl-2,6-diphenylthiopyrylium?
4-methyl-2,6-diphenylthiopyrylium has a molecular weight of 263.38 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-diphenylthiopyrylium is sourced from PubChem (CID 3562913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).