C23H22N4OS2 — CID 3563699
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 3563699) has the molecular formula C23H22N4OS2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 3563699 |
| Molecular Formula | C23H22N4OS2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)c3cc(C)n(-c4ccccc4)c3C)s2)c1 |
| InChI | InChI=1S/C23H22N4OS2/c1-15-8-7-9-18(12-15)24-22-25-26-23(30-22)29-14-21(28)20-13-16(2)27(17(20)3)19-10-5-4-6-11-19/h4-13H,14H2,1-3H3,(H,24,25) |
| InChIKey | IXYIGJXLFNRPEW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|