About cyanomethyl 2-amino-3,5-dibromobenzoate
cyanomethyl 2-amino-3,5-dibromobenzoate (PubChem CID 35646034) has the molecular formula C9H6Br2N2O2
and a molecular weight of 333.97 g/mol. Its IUPAC name is cyanomethyl 2-amino-3,5-dibromobenzoate.
Molecular Properties
| Compound Name | cyanomethyl 2-amino-3,5-dibromobenzoate |
| PubChem CID | 35646034 |
| Molecular Formula | C9H6Br2N2O2 |
| Molecular Weight | 333.97 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | cyanomethyl 2-amino-3,5-dibromobenzoate |
| SMILES | N#CCOC(=O)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C9H6Br2N2O2/c10-5-3-6(8(13)7(11)4-5)9(14)15-2-1-12/h3-4H,2,13H2 |
| InChIKey | CFJADRQEMXFQPT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.97 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl 2-amino-3,5-dibromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 2-amino-3,5-dibromobenzoate?
The IUPAC name of cyanomethyl 2-amino-3,5-dibromobenzoate (CID 35646034) is cyanomethyl 2-amino-3,5-dibromobenzoate.
What is the SMILES notation for cyanomethyl 2-amino-3,5-dibromobenzoate?
The canonical SMILES for cyanomethyl 2-amino-3,5-dibromobenzoate is N#CCOC(=O)c1cc(Br)cc(Br)c1N.
What is the InChIKey of cyanomethyl 2-amino-3,5-dibromobenzoate?
The InChIKey is CFJADRQEMXFQPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br2N2O2/c10-5-3-6(8(13)7(11)4-5)9(14)15-2-1-12/h3-4H,2,13H2.
What are the key properties of cyanomethyl 2-amino-3,5-dibromobenzoate?
cyanomethyl 2-amino-3,5-dibromobenzoate has a molecular weight of 333.97 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 2-amino-3,5-dibromobenzoate is sourced from PubChem (CID 35646034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).