C25H30N2O5 — CID 35647240
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 35647240) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 35647240 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)OCC(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N2O5/c1-2-31-22-11-7-6-10-21(22)25(30)26-17-24(29)32-18-23(28)27-14-12-20(13-15-27)16-19-8-4-3-5-9-19/h3-11,20H,2,12-18H2,1H3,(H,26,30) |
| InChIKey | IDLIJFZKXXCNAV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |