About 5-hexyl-1,3-thiazol-2-amine
5-hexyl-1,3-thiazol-2-amine (PubChem CID 3565002) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 5-hexyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-hexyl-1,3-thiazol-2-amine |
| PubChem CID | 3565002 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-hexyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCc1cnc(N)s1 |
| InChI | InChI=1S/C9H16N2S/c1-2-3-4-5-6-8-7-11-9(10)12-8/h7H,2-6H2,1H3,(H2,10,11) |
| InChIKey | ZDEVQPCYUARWNW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-1,3-thiazol-2-amine?
The IUPAC name of 5-hexyl-1,3-thiazol-2-amine (CID 3565002) is 5-hexyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-hexyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-hexyl-1,3-thiazol-2-amine is CCCCCCc1cnc(N)s1.
What is the InChIKey of 5-hexyl-1,3-thiazol-2-amine?
The InChIKey is ZDEVQPCYUARWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-2-3-4-5-6-8-7-11-9(10)12-8/h7H,2-6H2,1H3,(H2,10,11).
What are the key properties of 5-hexyl-1,3-thiazol-2-amine?
5-hexyl-1,3-thiazol-2-amine has a molecular weight of 184.31 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-1,3-thiazol-2-amine is sourced from PubChem (CID 3565002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).