C26H31N5O4 — CID 3565114
3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 3565114) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3565114 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCCCN3CCCCC3C)n(-c3ccc([N+](=O)[O-])cc3)n2)c1 |
| InChI | InChI=1S/C26H31N5O4/c1-19-7-3-4-15-29(19)16-6-14-27-26(32)25-18-24(20-8-5-9-23(17-20)35-2)28-30(25)21-10-12-22(13-11-21)31(33)34/h5,8-13,17-19H,3-4,6-7,14-16H2,1-2H3,(H,27,32) |
| InChIKey | JBUISXMZKKNMGU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|