C8H6F6N4O — CID 3565125
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-pyrimidin-2-ylurea (PubChem CID 3565125) has the molecular formula C8H6F6N4O and a molecular weight of 288.15 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-pyrimidin-2-ylurea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-pyrimidin-2-ylurea |
|---|---|
| PubChem CID | 3565125 |
| Molecular Formula | C8H6F6N4O |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-pyrimidin-2-ylurea |
| SMILES | O=C(Nc1ncccn1)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F6N4O/c9-7(10,11)4(8(12,13)14)17-6(19)18-5-15-2-1-3-16-5/h1-4H,(H2,15,16,17,18,19) |
| InChIKey | OIFDXKATVOPEFC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |