C25H23NO3 — CID 3565157
7-methyl-10-(2-phenylpropyl)-9,11-dihydroisochromeno[4,3-g][1,3]benzoxazin-5-one (PubChem CID 3565157) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 7-methyl-10-(2-phenylpropyl)-9,11-dihydroisochromeno[4,3-g][1,3]benzoxazin-5-one.
| Compound Name | 7-methyl-10-(2-phenylpropyl)-9,11-dihydroisochromeno[4,3-g][1,3]benzoxazin-5-one |
|---|---|
| PubChem CID | 3565157 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 7-methyl-10-(2-phenylpropyl)-9,11-dihydroisochromeno[4,3-g][1,3]benzoxazin-5-one |
| SMILES | Cc1c2c(cc3c1oc(=O)c1ccccc13)CN(CC(C)c1ccccc1)CO2 |
| InChI | InChI=1S/C25H23NO3/c1-16(18-8-4-3-5-9-18)13-26-14-19-12-22-20-10-6-7-11-21(20)25(27)29-24(22)17(2)23(19)28-15-26/h3-12,16H,13-15H2,1-2H3 |
| InChIKey | CKEMGGRMAJNXHM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|