C17H25NO2 — CID 3565751
5-ethyl-9,9-dimethyl-1,2,3,4,4a,5,8,10-octahydrobenzo[c]quinolizine-6,7-dione (PubChem CID 3565751) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 5-ethyl-9,9-dimethyl-1,2,3,4,4a,5,8,10-octahydrobenzo[c]quinolizine-6,7-dione.
| Compound Name | 5-ethyl-9,9-dimethyl-1,2,3,4,4a,5,8,10-octahydrobenzo[c]quinolizine-6,7-dione |
|---|---|
| PubChem CID | 3565751 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 5-ethyl-9,9-dimethyl-1,2,3,4,4a,5,8,10-octahydrobenzo[c]quinolizine-6,7-dione |
| SMILES | CCC1C(=O)C2=C(CC(C)(C)CC2=O)N2CCCCC12 |
| InChI | InChI=1S/C17H25NO2/c1-4-11-12-7-5-6-8-18(12)13-9-17(2,3)10-14(19)15(13)16(11)20/h11-12H,4-10H2,1-3H3 |
| InChIKey | SZYRLEUXZRXBLL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|