C28H40O8 — CID 3565848
2-hydroxy-7-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one (PubChem CID 3565848) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is 2-hydroxy-7-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one.
| Compound Name | 2-hydroxy-7-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one |
|---|---|
| PubChem CID | 3565848 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-hydroxy-7-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one |
| SMILES | COC1CC(OC2CCC3(C)C(=CCC4(O)C3CCC35C(=O)OC6(C)OC43CCC65)C2)OC(C)C1O |
| InChI | InChI=1S/C28H40O8/c1-15-22(29)18(32-4)14-21(33-15)34-17-6-9-24(2)16(13-17)5-11-27(31)19(24)7-10-26-20-8-12-28(26,27)36-25(20,3)35-23(26)30/h5,15,17-22,29,31H,6-14H2,1-4H3 |
| InChIKey | LFFWFWSSQJTRKO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|