C35H29ClFN3O8 — CID 3565952
methyl 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(2-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 3565952) has the molecular formula C35H29ClFN3O8 and a molecular weight of 674.08 g/mol. Its IUPAC name is methyl 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(2-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(2-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3565952 |
| Molecular Formula | C35H29ClFN3O8 |
| Molecular Weight | 674.08 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | methyl 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(2-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(F)cc5)C(=O)C4(c4ccc(Cl)cc4)C3c3cc(OC)ccc3O)C2C1=O |
| InChI | InChI=1S/C35H29ClFN3O8/c1-47-21-11-14-27(41)25(15-21)29-22-12-13-23-28(32(44)39(30(23)42)34(46)48-2)24(22)16-26-31(43)40(38-20-9-7-19(37)8-10-20)33(45)35(26,29)17-3-5-18(36)6-4-17/h3-12,14-15,23-24,26,28-29,38,41H,13,16H2,1-2H3 |
| InChIKey | RTAPONXVVCZYKS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.08 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|