C22H21NO9 — CID 3566153
[4-[4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]phenyl] acetate (PubChem CID 3566153) has the molecular formula C22H21NO9 and a molecular weight of 443.41 g/mol. Its IUPAC name is [4-[4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]phenyl] acetate.
| Compound Name | [4-[4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 3566153 |
| Molecular Formula | C22H21NO9 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [4-[4-(diacetyloxymethyl)-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C3C(C2=O)C2(C(OC(C)=O)OC(C)=O)C=CC3(C)O2)cc1 |
| InChI | InChI=1S/C22H21NO9/c1-11(24)29-15-7-5-14(6-8-15)23-18(27)16-17(19(23)28)22(10-9-21(16,4)32-22)20(30-12(2)25)31-13(3)26/h5-10,16-17,20H,1-4H3 |
| InChIKey | MWDJUKCLWRCKSS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|