C12H11Br2NO3S2 — CID 3566476
4,5-dibromo-N-(2-hydroxy-2-phenylethyl)thiophene-2-sulfonamide (PubChem CID 3566476) has the molecular formula C12H11Br2NO3S2 and a molecular weight of 441.17 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-hydroxy-2-phenylethyl)thiophene-2-sulfonamide.
| Compound Name | 4,5-dibromo-N-(2-hydroxy-2-phenylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3566476 |
| Molecular Formula | C12H11Br2NO3S2 |
| Molecular Weight | 441.17 g/mol |
| Exact Mass | 438.85 |
| IUPAC Name | 4,5-dibromo-N-(2-hydroxy-2-phenylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(O)c1ccccc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H11Br2NO3S2/c13-9-6-11(19-12(9)14)20(17,18)15-7-10(16)8-4-2-1-3-5-8/h1-6,10,15-16H,7H2 |
| InChIKey | OASCLEKSLZHTBT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |