2-(2-ethylanilino)acetic acid

C10H13NO2 — CID 3566830

IUPAC2-(2-ethylanilino)acetic acid
SMILESCCc1ccccc1NCC(=O)O
InChIInChI=1S/C10H13NO2/c1-2-8-5-3-4-6-9(8)11-7-10(12)13/h3-6,11H,2,7H2,1H3,(H,12,13)
InChIKeyBEEISGQEGPVCKL-UHFFFAOYSA-N
MW179.22 g/mol
LogP1.75
Rot. Bonds4

About 2-(2-ethylanilino)acetic acid

2-(2-ethylanilino)acetic acid (PubChem CID 3566830) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-(2-ethylanilino)acetic acid.

Molecular Properties

Compound Name2-(2-ethylanilino)acetic acid
PubChem CID3566830
Molecular FormulaC10H13NO2
Molecular Weight179.22 g/mol
Exact Mass179.09
IUPAC Name2-(2-ethylanilino)acetic acid
SMILESCCc1ccccc1NCC(=O)O
InChIInChI=1S/C10H13NO2/c1-2-8-5-3-4-6-9(8)11-7-10(12)13/h3-6,11H,2,7H2,1H3,(H,12,13)
InChIKeyBEEISGQEGPVCKL-UHFFFAOYSA-N
XLogP1.75
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.22
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2-ethylanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethylanilino)acetic acid?
The IUPAC name of 2-(2-ethylanilino)acetic acid (CID 3566830) is 2-(2-ethylanilino)acetic acid.
What is the SMILES notation for 2-(2-ethylanilino)acetic acid?
The canonical SMILES for 2-(2-ethylanilino)acetic acid is CCc1ccccc1NCC(=O)O.
What is the InChIKey of 2-(2-ethylanilino)acetic acid?
The InChIKey is BEEISGQEGPVCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-8-5-3-4-6-9(8)11-7-10(12)13/h3-6,11H,2,7H2,1H3,(H,12,13).
What are the key properties of 2-(2-ethylanilino)acetic acid?
2-(2-ethylanilino)acetic acid has a molecular weight of 179.22 g/mol, XLogP of 1.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylanilino)acetic acid is sourced from PubChem (CID 3566830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).