C18H14BrN3OS2 — CID 3567270
3-(4-bromophenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 3567270) has the molecular formula C18H14BrN3OS2 and a molecular weight of 432.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | 3-(4-bromophenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 3567270 |
| Molecular Formula | C18H14BrN3OS2 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 3-(4-bromophenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | N#CC1=C2SCN(c3ccc(Br)cc3)CN2C(=O)CC1c1cccs1 |
| InChI | InChI=1S/C18H14BrN3OS2/c19-12-3-5-13(6-4-12)21-10-22-17(23)8-14(16-2-1-7-24-16)15(9-20)18(22)25-11-21/h1-7,14H,8,10-11H2 |
| InChIKey | NYXQXNLWIVMFGP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |