C18H21F3N4O4S — CID 35672961
1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea (PubChem CID 35672961) has the molecular formula C18H21F3N4O4S and a molecular weight of 446.45 g/mol. Its IUPAC name is 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 35672961 |
| Molecular Formula | C18H21F3N4O4S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)NCc2cccnc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N4O4S/c1-13-4-6-15(7-5-13)30(27,28)25-10-9-23-17(26)24-11-14-3-2-8-22-16(14)29-12-18(19,20)21/h2-8,25H,9-12H2,1H3,(H2,23,24,26) |
| InChIKey | OURAJBNEXQNYSQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|