C18H18ClN3O2S — CID 35673332
(2R)-2-(4-chloro-3-methylphenoxy)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]propanamide (PubChem CID 35673332) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-methylphenoxy)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]propanamide.
| Compound Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 35673332 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]propanamide |
| SMILES | Cc1cc(O[C@H](C)C(=O)Nc2ccnn2Cc2cccs2)ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O2S/c1-12-10-14(5-6-16(12)19)24-13(2)18(23)21-17-7-8-20-22(17)11-15-4-3-9-25-15/h3-10,13H,11H2,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | GOVJKDABTQEOQR-CYBMUJFWSA-N |
| XLogP | 4.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |